C34H36N5+ — CID 53235784
(4S,5S)-N-[(4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium-2-yl]-1,3-dimethyl-4,5-diphenylimidazolidin-2-imine (PubChem CID 53235784) has the molecular formula C34H36N5+ and a molecular weight of 514.70 g/mol. Its IUPAC name is (4S,5S)-N-[(4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium-2-yl]-1,3-dimethyl-4,5-diphenylimidazolidin-2-imine.
| Compound Name | (4S,5S)-N-[(4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium-2-yl]-1,3-dimethyl-4,5-diphenylimidazolidin-2-imine |
|---|---|
| PubChem CID | 53235784 |
| Molecular Formula | C34H36N5+ |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | (4S,5S)-N-[(4S,5S)-1,3-dimethyl-4,5-diphenyl-4,5-dihydroimidazol-1-ium-2-yl]-1,3-dimethyl-4,5-diphenylimidazolidin-2-imine |
| SMILES | CN1C(=NC2=[N+](C)[C@@H](c3ccccc3)[C@H](c3ccccc3)N2C)N(C)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H36N5/c1-36-29(25-17-9-5-10-18-25)30(26-19-11-6-12-20-26)37(2)33(36)35-34-38(3)31(27-21-13-7-14-22-27)32(39(34)4)28-23-15-8-16-24-28/h5-24,29-32H,1-4H3/q+1/t29-,30-,31-,32-/m0/s1 |
| InChIKey | MNLLEVSAYKUDQM-YDPTYEFTSA-N |
| XLogP | 6.13 |
| TPSA | 25.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|