C21H22O4 — CID 5323713
methyl 1-oxo-2-(4-oxopentan-2-yl)-3,4-dihydrophenanthrene-2-carboxylate (PubChem CID 5323713) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl 1-oxo-2-(4-oxopentan-2-yl)-3,4-dihydrophenanthrene-2-carboxylate.
| Compound Name | methyl 1-oxo-2-(4-oxopentan-2-yl)-3,4-dihydrophenanthrene-2-carboxylate |
|---|---|
| PubChem CID | 5323713 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | methyl 1-oxo-2-(4-oxopentan-2-yl)-3,4-dihydrophenanthrene-2-carboxylate |
| SMILES | COC(=O)C1(C(C)CC(C)=O)CCc2c(ccc3ccccc23)C1=O |
| InChI | InChI=1S/C21H22O4/c1-13(12-14(2)22)21(20(24)25-3)11-10-17-16-7-5-4-6-15(16)8-9-18(17)19(21)23/h4-9,13H,10-12H2,1-3H3 |
| InChIKey | XNAHEJKRRSABEU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|