C15H15NO3 — CID 82046178
methyl 4-amino-2,3-dihydrobenzo[h]chromene-4-carboxylate (PubChem CID 82046178) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is methyl 4-amino-2,3-dihydrobenzo[h]chromene-4-carboxylate.
| Compound Name | methyl 4-amino-2,3-dihydrobenzo[h]chromene-4-carboxylate |
|---|---|
| PubChem CID | 82046178 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | methyl 4-amino-2,3-dihydrobenzo[h]chromene-4-carboxylate |
| SMILES | COC(=O)C1(N)CCOc2c1ccc1ccccc21 |
| InChI | InChI=1S/C15H15NO3/c1-18-14(17)15(16)8-9-19-13-11-5-3-2-4-10(11)6-7-12(13)15/h2-7H,8-9,16H2,1H3 |
| InChIKey | HXKRODOQXRFYQC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |