About CID 53243292
CID 53243292 (PubChem CID 53243292) has the molecular formula C24H23FeN3O5+2
and a molecular weight of 489.31 g/mol.
Molecular Properties
| Compound Name | CID 53243292 |
| PubChem CID | 53243292 |
| Molecular Formula | C24H23FeN3O5+2 |
| Molecular Weight | 489.31 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1c([C]2[CH][CH][CH][CH]2)nn(CCO)c1-c1ccc([N+](=O)[O-])cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C19H18N3O5.C5H5.Fe/c1-2-27-19(24)16-17(13-5-3-4-6-13)20-21(11-12-23)18(16)14-7-9-15(10-8-14)22(25)26;1-2-4-5-3-1;/h3-10,23H,2,11-12H2,1H3;1-5H;/q;;+2 |
| InChIKey | VNOJDBYVHQCSAF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 53243292 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53243292?
The IUPAC name of CID 53243292 (CID 53243292) is not available.
What is the SMILES notation for CID 53243292?
The canonical SMILES for CID 53243292 is CCOC(=O)c1c([C]2[CH][CH][CH][CH]2)nn(CCO)c1-c1ccc([N+](=O)[O-])cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 53243292?
The InChIKey is VNOJDBYVHQCSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N3O5.C5H5.Fe/c1-2-27-19(24)16-17(13-5-3-4-6-13)20-21(11-12-23)18(16)14-7-9-15(10-8-14)22(25)26;1-2-4-5-3-1;/h3-10,23H,2,11-12H2,1H3;1-5H;/q;;+2.
What are the key properties of CID 53243292?
CID 53243292 has a molecular weight of 489.31 g/mol, XLogP of 3.40, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53243292 is sourced from PubChem (CID 53243292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).