About CID 57408961
CID 57408961 (PubChem CID 57408961) has the molecular formula C25H24FeN4O4+2
and a molecular weight of 500.34 g/mol.
Molecular Properties
| Compound Name | CID 57408961 |
| PubChem CID | 57408961 |
| Molecular Formula | C25H24FeN4O4+2 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1c([C]2[CH][CH][CH][CH]2)nc(N(C)C)nc1-c1ccc([N+](=O)[O-])cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C20H19N4O4.C5H5.Fe/c1-4-28-19(25)16-17(13-7-5-6-8-13)21-20(23(2)3)22-18(16)14-9-11-15(12-10-14)24(26)27;1-2-4-5-3-1;/h5-12H,4H2,1-3H3;1-5H;/q;;+2 |
| InChIKey | BWPSVIXFWDUOER-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 57408961 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57408961?
The IUPAC name of CID 57408961 (CID 57408961) is not available.
What is the SMILES notation for CID 57408961?
The canonical SMILES for CID 57408961 is CCOC(=O)c1c([C]2[CH][CH][CH][CH]2)nc(N(C)C)nc1-c1ccc([N+](=O)[O-])cc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 57408961?
The InChIKey is BWPSVIXFWDUOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N4O4.C5H5.Fe/c1-4-28-19(25)16-17(13-7-5-6-8-13)21-20(23(2)3)22-18(16)14-9-11-15(12-10-14)24(26)27;1-2-4-5-3-1;/h5-12H,4H2,1-3H3;1-5H;/q;;+2.
What are the key properties of CID 57408961?
CID 57408961 has a molecular weight of 500.34 g/mol, XLogP of 4.07, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57408961 is sourced from PubChem (CID 57408961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).