C12H18O3 — CID 53243681
(1'S,3'aS,7'aR)-3'a-methylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-1H-indene]-1'-ol (PubChem CID 53243681) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (1'S,3'aS,7'aR)-3'a-methylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-1H-indene]-1'-ol.
| Compound Name | (1'S,3'aS,7'aR)-3'a-methylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-1H-indene]-1'-ol |
|---|---|
| PubChem CID | 53243681 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (1'S,3'aS,7'aR)-3'a-methylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-1H-indene]-1'-ol |
| SMILES | C[C@]12C=C[C@H](O)[C@@H]1CC1(CC2)OCCO1 |
| InChI | InChI=1S/C12H18O3/c1-11-3-2-10(13)9(11)8-12(5-4-11)14-6-7-15-12/h2-3,9-10,13H,4-8H2,1H3/t9-,10-,11+/m0/s1 |
| InChIKey | OXYVWBVSCPULHC-GARJFASQSA-N |
| XLogP | 1.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|