C15H24O3 — CID 139672006
[(1S,4R,7aR)-7a-methyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,3a,4,5,6,7-hexahydroinden-4-yl]methanol (PubChem CID 139672006) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is [(1S,4R,7aR)-7a-methyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,3a,4,5,6,7-hexahydroinden-4-yl]methanol.
| Compound Name | [(1S,4R,7aR)-7a-methyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,3a,4,5,6,7-hexahydroinden-4-yl]methanol |
|---|---|
| PubChem CID | 139672006 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [(1S,4R,7aR)-7a-methyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,3a,4,5,6,7-hexahydroinden-4-yl]methanol |
| SMILES | CC1([C@H]2C=CC3[C@H](CO)CCC[C@]32C)OCCO1 |
| InChI | InChI=1S/C15H24O3/c1-14-7-3-4-11(10-16)12(14)5-6-13(14)15(2)17-8-9-18-15/h5-6,11-13,16H,3-4,7-10H2,1-2H3/t11-,12?,13-,14+/m0/s1 |
| InChIKey | XQHZJNPSKBGKGW-FUDCBSFHSA-N |
| XLogP | 2.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|