C19H28O3 — CID 146166968
[(1R,4aS,10aR)-1-ethenylspiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-4a-yl]methanol (PubChem CID 146166968) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is [(1R,4aS,10aR)-1-ethenylspiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-4a-yl]methanol.
| Compound Name | [(1R,4aS,10aR)-1-ethenylspiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-4a-yl]methanol |
|---|---|
| PubChem CID | 146166968 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [(1R,4aS,10aR)-1-ethenylspiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-4a-yl]methanol |
| SMILES | C=C[C@H]1CCC[C@@]2(CO)C3=C(CC[C@H]12)CC1(CC3)OCCO1 |
| InChI | InChI=1S/C19H28O3/c1-2-14-4-3-8-18(13-20)16(14)6-5-15-12-19(9-7-17(15)18)21-10-11-22-19/h2,14,16,20H,1,3-13H2/t14-,16+,18-/m0/s1 |
| InChIKey | LSUFYNILBMMLAK-LESCRADOSA-N |
| XLogP | 3.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|