C14H22O4 — CID 90662536
(1'R,4'S,8'aR)-8'a-(hydroxymethyl)-4'-methylspiro[1,3-dioxolane-2,7'-1,4,4a,5,6,8-hexahydronaphthalene]-1'-ol (PubChem CID 90662536) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1'R,4'S,8'aR)-8'a-(hydroxymethyl)-4'-methylspiro[1,3-dioxolane-2,7'-1,4,4a,5,6,8-hexahydronaphthalene]-1'-ol.
| Compound Name | (1'R,4'S,8'aR)-8'a-(hydroxymethyl)-4'-methylspiro[1,3-dioxolane-2,7'-1,4,4a,5,6,8-hexahydronaphthalene]-1'-ol |
|---|---|
| PubChem CID | 90662536 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1'R,4'S,8'aR)-8'a-(hydroxymethyl)-4'-methylspiro[1,3-dioxolane-2,7'-1,4,4a,5,6,8-hexahydronaphthalene]-1'-ol |
| SMILES | C[C@H]1C=C[C@@H](O)[C@]2(CO)CC3(CCC12)OCCO3 |
| InChI | InChI=1S/C14H22O4/c1-10-2-3-12(16)13(9-15)8-14(5-4-11(10)13)17-6-7-18-14/h2-3,10-12,15-16H,4-9H2,1H3/t10-,11?,12+,13-/m0/s1 |
| InChIKey | GPAQGPDCNKWUAK-USLXRJLDSA-N |
| XLogP | 1.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|