C20H34O3 — CID 10805807
(1'R,4'aS,8'aS)-1'-butyl-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,7'-4,4a,6,8-tetrahydronaphthalene]-1'-ol (PubChem CID 10805807) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1'R,4'aS,8'aS)-1'-butyl-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,7'-4,4a,6,8-tetrahydronaphthalene]-1'-ol.
| Compound Name | (1'R,4'aS,8'aS)-1'-butyl-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,7'-4,4a,6,8-tetrahydronaphthalene]-1'-ol |
|---|---|
| PubChem CID | 10805807 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1'R,4'aS,8'aS)-1'-butyl-2',5',5',8'a-tetramethylspiro[1,3-dioxolane-2,7'-4,4a,6,8-tetrahydronaphthalene]-1'-ol |
| SMILES | CCCC[C@@]1(O)C(C)=CC[C@H]2C(C)(C)CC3(C[C@@]21C)OCCO3 |
| InChI | InChI=1S/C20H34O3/c1-6-7-10-20(21)15(2)8-9-16-17(3,4)13-19(14-18(16,20)5)22-11-12-23-19/h8,16,21H,6-7,9-14H2,1-5H3/t16-,18-,20+/m0/s1 |
| InChIKey | PWYIOQDKEALHBR-XKGZKEIXSA-N |
| XLogP | 4.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|