C18H25O6P — CID 53244056
ethyl 6-dimethoxyphosphoryl-3-[hydroxy(phenyl)methyl]cyclohexene-1-carboxylate (PubChem CID 53244056) has the molecular formula C18H25O6P and a molecular weight of 368.37 g/mol. Its IUPAC name is ethyl 6-dimethoxyphosphoryl-3-[hydroxy(phenyl)methyl]cyclohexene-1-carboxylate.
| Compound Name | ethyl 6-dimethoxyphosphoryl-3-[hydroxy(phenyl)methyl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 53244056 |
| Molecular Formula | C18H25O6P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl 6-dimethoxyphosphoryl-3-[hydroxy(phenyl)methyl]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(C(O)c2ccccc2)CCC1P(=O)(OC)OC |
| InChI | InChI=1S/C18H25O6P/c1-4-24-18(20)15-12-14(17(19)13-8-6-5-7-9-13)10-11-16(15)25(21,22-2)23-3/h5-9,12,14,16-17,19H,4,10-11H2,1-3H3 |
| InChIKey | KHKINESUUIUAPJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|