C31H45N3O2 — CID 53252321
5-[4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]piperazin-1-yl]pentyl 2-aminoacetate (PubChem CID 53252321) has the molecular formula C31H45N3O2 and a molecular weight of 491.72 g/mol. Its IUPAC name is 5-[4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]piperazin-1-yl]pentyl 2-aminoacetate.
| Compound Name | 5-[4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]piperazin-1-yl]pentyl 2-aminoacetate |
|---|---|
| PubChem CID | 53252321 |
| Molecular Formula | C31H45N3O2 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.35 |
| IUPAC Name | 5-[4-[3-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)phenyl]piperazin-1-yl]pentyl 2-aminoacetate |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCN(CCCCCOC(=O)CN)CC4)c3)ccc21 |
| InChI | InChI=1S/C31H45N3O2/c1-30(2)13-14-31(3,4)28-22-25(11-12-27(28)30)24-9-8-10-26(21-24)34-18-16-33(17-19-34)15-6-5-7-20-36-29(35)23-32/h8-12,21-22H,5-7,13-20,23,32H2,1-4H3 |
| InChIKey | JNOFZXZFZSEQCP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|