C19H15N5O — CID 5325276
N'-[(Z)-2-(benzylideneamino)-1,2-dicyanoethenyl]-N-phenylmethoxymethanimidamide (PubChem CID 5325276) has the molecular formula C19H15N5O and a molecular weight of 329.36 g/mol. Its IUPAC name is N'-[(Z)-2-(benzylideneamino)-1,2-dicyanoethenyl]-N-phenylmethoxymethanimidamide.
| Compound Name | N'-[(Z)-2-(benzylideneamino)-1,2-dicyanoethenyl]-N-phenylmethoxymethanimidamide |
|---|---|
| PubChem CID | 5325276 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N'-[(Z)-2-(benzylideneamino)-1,2-dicyanoethenyl]-N-phenylmethoxymethanimidamide |
| SMILES | N#CC(/N=C/NOCc1ccccc1)=C(C#N)/N=C/c1ccccc1 |
| InChI | InChI=1S/C19H15N5O/c20-11-18(22-13-16-7-3-1-4-8-16)19(12-21)23-15-24-25-14-17-9-5-2-6-10-17/h1-10,13,15H,14H2,(H,23,24)/b19-18-,22-13+ |
| InChIKey | NJSPMZAGGFBLGI-MRYDNHKSSA-N |
| XLogP | 3.11 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|