C19H15N5O4 — CID 136854426
N'-[(E)-1,2-dicyano-2-[(3,4,5-trihydroxyphenyl)methylideneamino]ethenyl]-N-phenylmethoxymethanimidamide (PubChem CID 136854426) has the molecular formula C19H15N5O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is N'-[(E)-1,2-dicyano-2-[(3,4,5-trihydroxyphenyl)methylideneamino]ethenyl]-N-phenylmethoxymethanimidamide.
| Compound Name | N'-[(E)-1,2-dicyano-2-[(3,4,5-trihydroxyphenyl)methylideneamino]ethenyl]-N-phenylmethoxymethanimidamide |
|---|---|
| PubChem CID | 136854426 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N'-[(E)-1,2-dicyano-2-[(3,4,5-trihydroxyphenyl)methylideneamino]ethenyl]-N-phenylmethoxymethanimidamide |
| SMILES | N#CC(/N=C/NOCc1ccccc1)=C(C#N)\N=C\c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C19H15N5O4/c20-8-15(22-10-14-6-17(25)19(27)18(26)7-14)16(9-21)23-12-24-28-11-13-4-2-1-3-5-13/h1-7,10,12,25-27H,11H2,(H,23,24)/b16-15+,22-10+ |
| InChIKey | JDIRPVIDMBQLEN-DSWHQLSPSA-N |
| XLogP | 2.23 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|