C13H9F3N2 — CID 53254110
4-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carbonitrile (PubChem CID 53254110) has the molecular formula C13H9F3N2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 4-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carbonitrile.
| Compound Name | 4-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 53254110 |
| Molecular Formula | C13H9F3N2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-methyl-2-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carbonitrile |
| SMILES | Cc1c[nH]c(-c2cccc(C(F)(F)F)c2)c1C#N |
| InChI | InChI=1S/C13H9F3N2/c1-8-7-18-12(11(8)6-17)9-3-2-4-10(5-9)13(14,15)16/h2-5,7,18H,1H3 |
| InChIKey | NVMZYVKVQJFGGD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |