C20H23F3N4OS — CID 53257114
N-(4,6-dimethyl-2-pyridinyl)-4-[3-methoxy-5-(trifluoromethyl)phenyl]piperazine-1-carbothioamide (PubChem CID 53257114) has the molecular formula C20H23F3N4OS and a molecular weight of 424.49 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-4-[3-methoxy-5-(trifluoromethyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-4-[3-methoxy-5-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 53257114 |
| Molecular Formula | C20H23F3N4OS |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-4-[3-methoxy-5-(trifluoromethyl)phenyl]piperazine-1-carbothioamide |
| SMILES | COc1cc(N2CCN(C(=S)Nc3cc(C)cc(C)n3)CC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N4OS/c1-13-8-14(2)24-18(9-13)25-19(29)27-6-4-26(5-7-27)16-10-15(20(21,22)23)11-17(12-16)28-3/h8-12H,4-7H2,1-3H3,(H,24,25,29) |
| InChIKey | UJDFJVKMTUFCHX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|