C14H21NO3 — CID 53257424
(2E)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)acetamide (PubChem CID 53257424) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (2E)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)acetamide.
| Compound Name | (2E)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 53257424 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (2E)-2-[(4aS,8aS)-8-oxo-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-ylidene]-N-(2-hydroxyethyl)acetamide |
| SMILES | O=C(/C=C1\CC[C@@H]2CCCC(=O)[C@H]2C1)NCCO |
| InChI | InChI=1S/C14H21NO3/c16-7-6-15-14(18)9-10-4-5-11-2-1-3-13(17)12(11)8-10/h9,11-12,16H,1-8H2,(H,15,18)/b10-9+/t11-,12-/m0/s1 |
| InChIKey | FPVCQAWSAUTLIR-GSGCRYEPSA-N |
| XLogP | 1.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|