C12H25NO3S — CID 53260506
methyl N-[(E)-2,2,6,6-tetramethylhept-4-en-3-yl]sulfamate (PubChem CID 53260506) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is methyl N-[(E)-2,2,6,6-tetramethylhept-4-en-3-yl]sulfamate.
| Compound Name | methyl N-[(E)-2,2,6,6-tetramethylhept-4-en-3-yl]sulfamate |
|---|---|
| PubChem CID | 53260506 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | methyl N-[(E)-2,2,6,6-tetramethylhept-4-en-3-yl]sulfamate |
| SMILES | COS(=O)(=O)NC(/C=C/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H25NO3S/c1-11(2,3)9-8-10(12(4,5)6)13-17(14,15)16-7/h8-10,13H,1-7H3/b9-8+ |
| InChIKey | AJRZEUHZJLSOAN-CMDGGOBGSA-N |
| XLogP | 2.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|