C20H24ClNO5 — CID 53261126
diethyl 3-acetyl-1-(4-chlorophenyl)-6-methyl-2,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 53261126) has the molecular formula C20H24ClNO5 and a molecular weight of 393.87 g/mol. Its IUPAC name is diethyl 3-acetyl-1-(4-chlorophenyl)-6-methyl-2,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 3-acetyl-1-(4-chlorophenyl)-6-methyl-2,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 53261126 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | diethyl 3-acetyl-1-(4-chlorophenyl)-6-methyl-2,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccc(Cl)cc2)CC(C(C)=O)(C(=O)OCC)C1 |
| InChI | InChI=1S/C20H24ClNO5/c1-5-26-18(24)17-11-20(14(4)23,19(25)27-6-2)12-22(13(17)3)16-9-7-15(21)8-10-16/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | OMQAASNQNPRDKQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|