C19H17N3O2S2 — CID 53261970
5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2-propyl-3H-isoindol-1-one (PubChem CID 53261970) has the molecular formula C19H17N3O2S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2-propyl-3H-isoindol-1-one.
| Compound Name | 5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2-propyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 53261970 |
| Molecular Formula | C19H17N3O2S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 5-[5-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]thiophen-2-yl]-2-propyl-3H-isoindol-1-one |
| SMILES | CCCN1Cc2cc(-c3ccc(/C=C4/NC(=S)NC4=O)s3)ccc2C1=O |
| InChI | InChI=1S/C19H17N3O2S2/c1-2-7-22-10-12-8-11(3-5-14(12)18(22)24)16-6-4-13(26-16)9-15-17(23)21-19(25)20-15/h3-6,8-9H,2,7,10H2,1H3,(H2,20,21,23,25)/b15-9+ |
| InChIKey | FCBNVQPCZZJZDP-OQLLNIDSSA-N |
| XLogP | 3.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|