C24H19BrN6O — CID 53265532
N-[(E)-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265532) has the molecular formula C24H19BrN6O and a molecular weight of 487.36 g/mol. Its IUPAC name is N-[(E)-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265532 |
| Molecular Formula | C24H19BrN6O |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[(E)-[5-bromo-2-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1ccc(COc2ccc(Br)cc2/C=N/Nc2nnc3c(n2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C24H19BrN6O/c1-15-6-8-16(9-7-15)14-32-21-11-10-18(25)12-17(21)13-26-30-24-28-23-22(29-31-24)19-4-2-3-5-20(19)27-23/h2-13H,14H2,1H3,(H2,27,28,30,31)/b26-13+ |
| InChIKey | DBVUXKXZNBJDTQ-LGJNPRDNSA-N |
| XLogP | 5.60 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|