C11H6ClNO3S2 — CID 53273658
2-[(4-chloro-5-formyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid (PubChem CID 53273658) has the molecular formula C11H6ClNO3S2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-[(4-chloro-5-formyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid.
| Compound Name | 2-[(4-chloro-5-formyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 53273658 |
| Molecular Formula | C11H6ClNO3S2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 298.95 |
| IUPAC Name | 2-[(4-chloro-5-formyl-1,3-thiazol-2-yl)sulfanyl]benzoic acid |
| SMILES | O=Cc1sc(Sc2ccccc2C(=O)O)nc1Cl |
| InChI | InChI=1S/C11H6ClNO3S2/c12-9-8(5-14)18-11(13-9)17-7-4-2-1-3-6(7)10(15)16/h1-5H,(H,15,16) |
| InChIKey | MIKGITATSRRBLJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|