C22H27N4O3+ — CID 53274432
4-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one (PubChem CID 53274432) has the molecular formula C22H27N4O3+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53274432 |
| Molecular Formula | C22H27N4O3+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-[[(1-benzylpiperidin-4-yl)amino]methyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2CNC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N4O3/c1-28-20-9-7-19(8-10-20)26-21(22(27)29-24-26)15-23-18-11-13-25(14-12-18)16-17-5-3-2-4-6-17/h2-10,18,23H,11-16H2,1H3/p+1 |
| InChIKey | DKECZYVOOKJFRO-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|