C34H48N4O9 — CID 5327493
oxolan-3-yl N-[(2S)-1-[(16R)-12,15-dioxo-13-propan-2-yl-2,5,8-trioxa-11,14,17-triazabicyclo[17.2.2]tricosa-1(21),19,22-trien-16-yl]-1-hydroxy-3-phenylpropan-2-yl]carbamate (PubChem CID 5327493) has the molecular formula C34H48N4O9 and a molecular weight of 656.78 g/mol. Its IUPAC name is oxolan-3-yl N-[(2S)-1-[(16R)-12,15-dioxo-13-propan-2-yl-2,5,8-trioxa-11,14,17-triazabicyclo[17.2.2]tricosa-1(21),19,22-trien-16-yl]-1-hydroxy-3-phenylpropan-2-yl]carbamate.
| Compound Name | oxolan-3-yl N-[(2S)-1-[(16R)-12,15-dioxo-13-propan-2-yl-2,5,8-trioxa-11,14,17-triazabicyclo[17.2.2]tricosa-1(21),19,22-trien-16-yl]-1-hydroxy-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 5327493 |
| Molecular Formula | C34H48N4O9 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | oxolan-3-yl N-[(2S)-1-[(16R)-12,15-dioxo-13-propan-2-yl-2,5,8-trioxa-11,14,17-triazabicyclo[17.2.2]tricosa-1(21),19,22-trien-16-yl]-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)C1NC(=O)[C@@H](C(O)[C@H](Cc2ccccc2)NC(=O)OC2CCOC2)NCc2ccc(cc2)OCCOCCOCCNC1=O |
| InChI | InChI=1S/C34H48N4O9/c1-23(2)29-32(40)35-13-15-43-16-17-44-18-19-46-26-10-8-25(9-11-26)21-36-30(33(41)38-29)31(39)28(20-24-6-4-3-5-7-24)37-34(42)47-27-12-14-45-22-27/h3-11,23,27-31,36,39H,12-22H2,1-2H3,(H,35,40)(H,37,42)(H,38,41)/t27?,28-,29?,30+,31?/m0/s1 |
| InChIKey | PWEJSYALDYQGFY-UFSCFTEJSA-N |
| XLogP | 1.31 |
| TPSA | 165.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|