C20H24Cl2N2O4S — CID 53282732
1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[3-(furan-2-yl)propyl]piperidine-3-carboxamide (PubChem CID 53282732) has the molecular formula C20H24Cl2N2O4S and a molecular weight of 459.40 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[3-(furan-2-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[3-(furan-2-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53282732 |
| Molecular Formula | C20H24Cl2N2O4S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methylsulfonyl]-N-[3-(furan-2-yl)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccco1)C1CCCN(S(=O)(=O)Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C20H24Cl2N2O4S/c21-18-8-1-9-19(22)17(18)14-29(26,27)24-11-3-5-15(13-24)20(25)23-10-2-6-16-7-4-12-28-16/h1,4,7-9,12,15H,2-3,5-6,10-11,13-14H2,(H,23,25) |
| InChIKey | VNNQSLVPVXNAER-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|