C17H14N4S — CID 5328407
4-N-(3-methylphenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,8-diamine (PubChem CID 5328407) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-N-(3-methylphenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,8-diamine.
| Compound Name | 4-N-(3-methylphenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,8-diamine |
|---|---|
| PubChem CID | 5328407 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-N-(3-methylphenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,8-diamine |
| SMILES | Cc1cccc(Nc2ncnc3c2sc2ccc(N)cc23)c1 |
| InChI | InChI=1S/C17H14N4S/c1-10-3-2-4-12(7-10)21-17-16-15(19-9-20-17)13-8-11(18)5-6-14(13)22-16/h2-9H,18H2,1H3,(H,19,20,21) |
| InChIKey | OIFDROVQDZHYPF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|