C15H12Cl2N4O — CID 5328625
2-amino-6-(2,6-dichlorophenyl)-8-ethylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 5328625) has the molecular formula C15H12Cl2N4O and a molecular weight of 335.19 g/mol. Its IUPAC name is 2-amino-6-(2,6-dichlorophenyl)-8-ethylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-amino-6-(2,6-dichlorophenyl)-8-ethylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 5328625 |
| Molecular Formula | C15H12Cl2N4O |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-amino-6-(2,6-dichlorophenyl)-8-ethylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2c(Cl)cccc2Cl)cc2cnc(N)nc21 |
| InChI | InChI=1S/C15H12Cl2N4O/c1-2-21-13-8(7-19-15(18)20-13)6-9(14(21)22)12-10(16)4-3-5-11(12)17/h3-7H,2H2,1H3,(H2,18,19,20) |
| InChIKey | RARNNEKMSBLJMX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |