C19H21N4O2S+ — CID 53289531
1-benzyl-3-ethyl-1-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]thiourea (PubChem CID 53289531) has the molecular formula C19H21N4O2S+ and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-1-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]thiourea.
| Compound Name | 1-benzyl-3-ethyl-1-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 53289531 |
| Molecular Formula | C19H21N4O2S+ |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-benzyl-3-ethyl-1-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]thiourea |
| SMILES | CCNC(=S)N(Cc1ccccc1)Cc1c(=O)o[nH][n+]1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-2-20-19(26)22(13-15-9-5-3-6-10-15)14-17-18(24)25-21-23(17)16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3,(H-,20,21,24,26)/p+1 |
| InChIKey | OZSSGTAMIARXMY-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 65.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|