C19H21N4O4S+ — CID 53277673
1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-phenylthiourea (PubChem CID 53277673) has the molecular formula C19H21N4O4S+ and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-phenylthiourea.
| Compound Name | 1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 53277673 |
| Molecular Formula | C19H21N4O4S+ |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-phenylthiourea |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2CN(CCO)C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N4O4S/c1-26-16-9-7-15(8-10-16)23-17(18(25)27-21-23)13-22(11-12-24)19(28)20-14-5-3-2-4-6-14/h2-10,24H,11-13H2,1H3,(H-,20,21,25,28)/p+1 |
| InChIKey | TVTIFQMTCGQAMG-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|