C21H23N4O6+ — CID 53277596
2-(4-methoxy-N-[2-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2-oxoethyl]anilino)acetic acid (PubChem CID 53277596) has the molecular formula C21H23N4O6+ and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-(4-methoxy-N-[2-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2-oxoethyl]anilino)acetic acid.
| Compound Name | 2-(4-methoxy-N-[2-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2-oxoethyl]anilino)acetic acid |
|---|---|
| PubChem CID | 53277596 |
| Molecular Formula | C21H23N4O6+ |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(4-methoxy-N-[2-[methyl-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]amino]-2-oxoethyl]anilino)acetic acid |
| SMILES | COc1ccc(N(CC(=O)O)CC(=O)N(C)Cc2c(=O)o[nH][n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N4O6/c1-23(12-18-21(29)31-22-25(18)16-6-4-3-5-7-16)19(26)13-24(14-20(27)28)15-8-10-17(30-2)11-9-15/h3-11H,12-14H2,1-2H3,(H-,22,27,28,29)/p+1 |
| InChIKey | YGGCSHMLFZGHTJ-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|