C20H19FN3O4+ — CID 53289962
N-cyclopropyl-4-fluoro-N-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]benzamide (PubChem CID 53289962) has the molecular formula C20H19FN3O4+ and a molecular weight of 384.39 g/mol. Its IUPAC name is N-cyclopropyl-4-fluoro-N-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-fluoro-N-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 53289962 |
| Molecular Formula | C20H19FN3O4+ |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | N-cyclopropyl-4-fluoro-N-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]benzamide |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2CN(C(=O)c2ccc(F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C20H18FN3O4/c1-27-17-10-8-16(9-11-17)24-18(20(26)28-22-24)12-23(15-6-7-15)19(25)13-2-4-14(21)5-3-13/h2-5,8-11,15H,6-7,12H2,1H3/p+1 |
| InChIKey | YQSNASDLTHSHTQ-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|