C15H19N4O3S+ — CID 53277576
3-cyclopropyl-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-1-methylthiourea (PubChem CID 53277576) has the molecular formula C15H19N4O3S+ and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-cyclopropyl-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-1-methylthiourea.
| Compound Name | 3-cyclopropyl-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 53277576 |
| Molecular Formula | C15H19N4O3S+ |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-cyclopropyl-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-1-methylthiourea |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2CN(C)C(=S)NC2CC2)cc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-18(15(23)16-10-3-4-10)9-13-14(20)22-17-19(13)11-5-7-12(21-2)8-6-11/h5-8,10H,3-4,9H2,1-2H3,(H-,16,17,20,23)/p+1 |
| InChIKey | BHWQXGQBTZYIDN-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|