C14H19N4O4S+ — CID 53289507
1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-methylthiourea (PubChem CID 53289507) has the molecular formula C14H19N4O4S+ and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-methylthiourea.
| Compound Name | 1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-methylthiourea |
|---|---|
| PubChem CID | 53289507 |
| Molecular Formula | C14H19N4O4S+ |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]methyl]-3-methylthiourea |
| SMILES | CNC(=S)N(CCO)Cc1c(=O)o[nH][n+]1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H18N4O4S/c1-15-14(23)17(7-8-19)9-12-13(20)22-16-18(12)10-3-5-11(21-2)6-4-10/h3-6,19H,7-9H2,1-2H3,(H-,15,16,20,23)/p+1 |
| InChIKey | AELBGYHXLRXKSJ-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|