C19H17N4O5+ — CID 53289970
N-cyclopropyl-3-nitro-N-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]benzamide (PubChem CID 53289970) has the molecular formula C19H17N4O5+ and a molecular weight of 381.37 g/mol. Its IUPAC name is N-cyclopropyl-3-nitro-N-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]benzamide.
| Compound Name | N-cyclopropyl-3-nitro-N-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53289970 |
| Molecular Formula | C19H17N4O5+ |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-cyclopropyl-3-nitro-N-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)methyl]benzamide |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N(Cc1c(=O)o[nH][n+]1-c1ccccc1)C1CC1 |
| InChI | InChI=1S/C19H16N4O5/c24-18(13-5-4-8-16(11-13)23(26)27)21(14-9-10-14)12-17-19(25)28-20-22(17)15-6-2-1-3-7-15/h1-8,11,14H,9-10,12H2/p+1 |
| InChIKey | ISWXZCISVRZKDV-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|