C23H26N3O6S2+ — CID 53291846
methyl 2-[[2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 53291846) has the molecular formula C23H26N3O6S2+ and a molecular weight of 504.61 g/mol. Its IUPAC name is methyl 2-[[2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 53291846 |
| Molecular Formula | C23H26N3O6S2+ |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | methyl 2-[[2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CSc2c(=O)o[nH][n+]2-c2ccc(OC)cc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C23H25N3O6S2/c1-30-15-11-9-14(10-12-15)26-21(23(29)32-25-26)33-13-18(27)24-20-19(22(28)31-2)16-7-5-3-4-6-8-17(16)34-20/h9-12H,3-8,13H2,1-2H3,(H-,24,25,27,28,29)/p+1 |
| InChIKey | WUJRYKOIWNRIEG-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|