C18H24N3O5S2+ — CID 53292246
ethyl 2-[[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 53292246) has the molecular formula C18H24N3O5S2+ and a molecular weight of 426.54 g/mol. Its IUPAC name is ethyl 2-[[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 53292246 |
| Molecular Formula | C18H24N3O5S2+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | ethyl 2-[[2-[(3-methyl-5-oxo-2H-oxadiazol-3-ium-4-yl)sulfanyl]acetyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2c(=O)o[nH][n+]2C)sc2c1CCCCCC2 |
| InChI | InChI=1S/C18H23N3O5S2/c1-3-25-17(23)14-11-8-6-4-5-7-9-12(11)28-15(14)19-13(22)10-27-16-18(24)26-20-21(16)2/h3-10H2,1-2H3,(H-,19,20,22,23,24)/p+1 |
| InChIKey | OMJWAIPCVOHSRK-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|