C25H30N3O6S2+ — CID 53294210
ethyl 2-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 53294210) has the molecular formula C25H30N3O6S2+ and a molecular weight of 532.66 g/mol. Its IUPAC name is ethyl 2-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 53294210 |
| Molecular Formula | C25H30N3O6S2+ |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | ethyl 2-[3-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CCSc2c(=O)o[nH][n+]2-c2ccc(OC)cc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H29N3O6S2/c1-3-33-24(30)21-18-8-6-4-5-7-9-19(18)36-22(21)26-20(29)14-15-35-23-25(31)34-27-28(23)16-10-12-17(32-2)13-11-16/h10-13H,3-9,14-15H2,1-2H3,(H-,26,27,29,30,31)/p+1 |
| InChIKey | RXFIHURYLHJJTJ-UHFFFAOYSA-O |
| XLogP | 4.27 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|