C24H28N3O5S2+ — CID 53292588
ethyl 2-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 53292588) has the molecular formula C24H28N3O5S2+ and a molecular weight of 502.64 g/mol. Its IUPAC name is ethyl 2-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 53292588 |
| Molecular Formula | C24H28N3O5S2+ |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | ethyl 2-[2-[(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2c(=O)o[nH][n+]2-c2ccccc2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C24H27N3O5S2/c1-3-31-23(29)19-17-13-9-4-5-10-14-18(17)34-21(19)25-20(28)15(2)33-22-24(30)32-26-27(22)16-11-7-6-8-12-16/h6-8,11-12,15H,3-5,9-10,13-14H2,1-2H3,(H-,25,26,28,29,30)/p+1 |
| InChIKey | OHYFPBQTQSNVAK-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|