C19H20N3O4S+ — CID 53292144
N-(2,6-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetamide (PubChem CID 53292144) has the molecular formula C19H20N3O4S+ and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 53292144 |
| Molecular Formula | C19H20N3O4S+ |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2SCC(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-12-5-4-6-13(2)17(12)20-16(23)11-27-18-19(24)26-21-22(18)14-7-9-15(25-3)10-8-14/h4-10H,11H2,1-3H3,(H-,20,21,23,24)/p+1 |
| InChIKey | NVJVLVZDYKIZTJ-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|