C16H13FN3O4+ — CID 53289599
N-(2-fluorophenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide (PubChem CID 53289599) has the molecular formula C16H13FN3O4+ and a molecular weight of 330.30 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 53289599 |
| Molecular Formula | C16H13FN3O4+ |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(2-fluorophenyl)-3-(4-methoxyphenyl)-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C16H12FN3O4/c1-23-11-8-6-10(7-9-11)20-14(16(22)24-19-20)15(21)18-13-5-3-2-4-12(13)17/h2-9H,1H3,(H-,18,19,21,22)/p+1 |
| InChIKey | AVEMMAXSADEFKM-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|