C11H12N3O4+ — CID 53290366
N-(4-methoxyphenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide (PubChem CID 53290366) has the molecular formula C11H12N3O4+ and a molecular weight of 250.23 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 53290366 |
| Molecular Formula | C11H12N3O4+ |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-(4-methoxyphenyl)-3-methyl-5-oxo-2H-oxadiazol-3-ium-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(=O)o[nH][n+]2C)cc1 |
| InChI | InChI=1S/C11H11N3O4/c1-14-9(11(16)18-13-14)10(15)12-7-3-5-8(17-2)6-4-7/h3-6H,1-2H3,(H-,12,13,15,16)/p+1 |
| InChIKey | HXMNXZDHCPRQQQ-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|