C13H15N3O2S — CID 53293965
(1E)-2-benzylsulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53293965) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is (1E)-2-benzylsulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)ethanimidate.
| Compound Name | (1E)-2-benzylsulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)ethanimidate |
|---|---|
| PubChem CID | 53293965 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (1E)-2-benzylsulfanyl-N-(3-ethyloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | CC[n+]1cc(/N=C(/[O-])CSCc2ccccc2)on1 |
| InChI | InChI=1S/C13H15N3O2S/c1-2-16-8-13(18-15-16)14-12(17)10-19-9-11-6-4-3-5-7-11/h3-8H,2,9-10H2,1H3 |
| InChIKey | XWVYECRSZHAXSV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 65.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|