C19H19N3O — CID 53298906
1-(2,3-dihydroindol-1-yl)-2-(3-methylindazol-1-yl)propan-1-one (PubChem CID 53298906) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-(3-methylindazol-1-yl)propan-1-one.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-(3-methylindazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 53298906 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-(3-methylindazol-1-yl)propan-1-one |
| SMILES | Cc1nn(C(C)C(=O)N2CCc3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C19H19N3O/c1-13-16-8-4-6-10-18(16)22(20-13)14(2)19(23)21-12-11-15-7-3-5-9-17(15)21/h3-10,14H,11-12H2,1-2H3 |
| InChIKey | PIAUZVWCDPTDQJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |