C18H15Br2N3O — CID 53299576
2-amino-5,8-dibromo-N-(2-phenylethyl)quinoline-3-carboxamide (PubChem CID 53299576) has the molecular formula C18H15Br2N3O and a molecular weight of 449.15 g/mol. Its IUPAC name is 2-amino-5,8-dibromo-N-(2-phenylethyl)quinoline-3-carboxamide.
| Compound Name | 2-amino-5,8-dibromo-N-(2-phenylethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 53299576 |
| Molecular Formula | C18H15Br2N3O |
| Molecular Weight | 449.15 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | 2-amino-5,8-dibromo-N-(2-phenylethyl)quinoline-3-carboxamide |
| SMILES | Nc1nc2c(Br)ccc(Br)c2cc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H15Br2N3O/c19-14-6-7-15(20)16-12(14)10-13(17(21)23-16)18(24)22-9-8-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H2,21,23)(H,22,24) |
| InChIKey | BYKWRIJCAGERJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.15 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |