C32H36Cl2N2O4 — CID 53301093
methyl (3S,4aS)-1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate (PubChem CID 53301093) has the molecular formula C32H36Cl2N2O4 and a molecular weight of 583.56 g/mol. Its IUPAC name is methyl (3S,4aS)-1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate.
| Compound Name | methyl (3S,4aS)-1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
|---|---|
| PubChem CID | 53301093 |
| Molecular Formula | C32H36Cl2N2O4 |
| Molecular Weight | 583.56 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | methyl (3S,4aS)-1-[(2,4-dichlorophenyl)methyl]-2-oxo-3-[2-oxo-2-(4-phenylpiperidin-1-yl)ethyl]-3,4,5,6,7,8-hexahydrocyclohepta[b]pyridine-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCCCC=C1N(Cc1ccc(Cl)cc1Cl)C(=O)[C@H](CC(=O)N1CCC(c3ccccc3)CC1)C2 |
| InChI | InChI=1S/C32H36Cl2N2O4/c1-40-31(39)32-15-7-3-6-10-28(32)36(21-24-11-12-26(33)19-27(24)34)30(38)25(20-32)18-29(37)35-16-13-23(14-17-35)22-8-4-2-5-9-22/h2,4-5,8-12,19,23,25H,3,6-7,13-18,20-21H2,1H3/t25-,32+/m1/s1 |
| InChIKey | WEEOKTIVTLLVGN-GOXGLGGOSA-N |
| XLogP | 6.76 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.56 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |