C28H42ClN3O5 — CID 53302485
3-(3-chlorophenyl)-1,1-diethyl-2-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]guanidine (PubChem CID 53302485) has the molecular formula C28H42ClN3O5 and a molecular weight of 536.11 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,1-diethyl-2-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]guanidine.
| Compound Name | 3-(3-chlorophenyl)-1,1-diethyl-2-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]guanidine |
|---|---|
| PubChem CID | 53302485 |
| Molecular Formula | C28H42ClN3O5 |
| Molecular Weight | 536.11 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 3-(3-chlorophenyl)-1,1-diethyl-2-[2-[[(1S,4S,5R,8S,9R,10S,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethyl]guanidine |
| SMILES | CCN(CC)/C(=N\CCO[C@H]1O[C@@H]2O[C@]3(C)CCC4[C@H](C)CC[C@@H]([C@H]1C)C42OO3)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C28H42ClN3O5/c1-6-32(7-2)26(31-21-10-8-9-20(29)17-21)30-15-16-33-24-19(4)23-12-11-18(3)22-13-14-27(5)35-25(34-24)28(22,23)37-36-27/h8-10,17-19,22-25H,6-7,11-16H2,1-5H3,(H,30,31)/t18-,19-,22?,23+,24+,25-,27+,28?/m1/s1 |
| InChIKey | FCPGJZXAKRJGBL-HAHMPTEHSA-N |
| XLogP | 5.67 |
| TPSA | 73.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.11 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|