C28H30F6N3OPS — CID 53302593
[6-(dimethylamino)-9-[2-(5,5-dimethyl-4H-1,3-oxazol-2-yl)phenyl]thioxanthen-3-ylidene]-dimethylazanium hexafluorophosphate (PubChem CID 53302593) has the molecular formula C28H30F6N3OPS and a molecular weight of 601.60 g/mol. Its IUPAC name is [6-(dimethylamino)-9-[2-(5,5-dimethyl-4H-1,3-oxazol-2-yl)phenyl]thioxanthen-3-ylidene]-dimethylazanium hexafluorophosphate.
| Compound Name | [6-(dimethylamino)-9-[2-(5,5-dimethyl-4H-1,3-oxazol-2-yl)phenyl]thioxanthen-3-ylidene]-dimethylazanium hexafluorophosphate |
|---|---|
| PubChem CID | 53302593 |
| Molecular Formula | C28H30F6N3OPS |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | [6-(dimethylamino)-9-[2-(5,5-dimethyl-4H-1,3-oxazol-2-yl)phenyl]thioxanthen-3-ylidene]-dimethylazanium hexafluorophosphate |
| SMILES | CN(C)c1ccc2c(-c3ccccc3C3=NCC(C)(C)O3)c3ccc(=[N+](C)C)cc-3sc2c1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C28H30N3OS.F6P/c1-28(2)17-29-27(32-28)21-10-8-7-9-20(21)26-22-13-11-18(30(3)4)15-24(22)33-25-16-19(31(5)6)12-14-23(25)26;1-7(2,3,4,5)6/h7-16H,17H2,1-6H3;/q+1;-1 |
| InChIKey | UKFXZTDFLCQNBY-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 27.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|