C28H30N3OSe+ — CID 11635224
[6-(dimethylamino)-9-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]selenoxanthen-3-ylidene]-dimethylazanium (PubChem CID 11635224) has the molecular formula C28H30N3OSe+ and a molecular weight of 503.53 g/mol. Its IUPAC name is [6-(dimethylamino)-9-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]selenoxanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]selenoxanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 11635224 |
| Molecular Formula | C28H30N3OSe+ |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [6-(dimethylamino)-9-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]selenoxanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3ccccc3C3=NC(C)(C)CO3)c3ccc(=[N+](C)C)cc-3[se]c2c1 |
| InChI | InChI=1S/C28H30N3OSe/c1-28(2)17-32-27(29-28)21-10-8-7-9-20(21)26-22-13-11-18(30(3)4)15-24(22)33-25-16-19(31(5)6)12-14-23(25)26/h7-16H,17H2,1-6H3/q+1 |
| InChIKey | AKJHBFDTAOZTBJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 27.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|