C25H25N2O2Se+ — CID 11620293
[6-(dimethylamino)-9-(2-methoxycarbonylphenyl)selenoxanthen-3-ylidene]-dimethylazanium (PubChem CID 11620293) has the molecular formula C25H25N2O2Se+ and a molecular weight of 464.45 g/mol. Its IUPAC name is [6-(dimethylamino)-9-(2-methoxycarbonylphenyl)selenoxanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-(2-methoxycarbonylphenyl)selenoxanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 11620293 |
| Molecular Formula | C25H25N2O2Se+ |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [6-(dimethylamino)-9-(2-methoxycarbonylphenyl)selenoxanthen-3-ylidene]-dimethylazanium |
| SMILES | COC(=O)c1ccccc1-c1c2ccc(=[N+](C)C)cc-2[se]c2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C25H25N2O2Se/c1-26(2)16-10-12-20-22(14-16)30-23-15-17(27(3)4)11-13-21(23)24(20)18-8-6-7-9-19(18)25(28)29-5/h6-15H,1-5H3/q+1 |
| InChIKey | YZIMXIWPWOMKSD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|