C42H41ClN4O8 — CID 52938936
[6-(dimethylamino)-9-[2-[2-[2-hydroxy-3-methoxy-6-(methylcarbamoyl)phenyl]-6-methoxy-3-(methylcarbamoyl)phenoxy]carbonylphenyl]xanthen-3-ylidene]-dimethylazanium chloride (PubChem CID 52938936) has the molecular formula C42H41ClN4O8 and a molecular weight of 765.26 g/mol. Its IUPAC name is [6-(dimethylamino)-9-[2-[2-[2-hydroxy-3-methoxy-6-(methylcarbamoyl)phenyl]-6-methoxy-3-(methylcarbamoyl)phenoxy]carbonylphenyl]xanthen-3-ylidene]-dimethylazanium chloride.
| Compound Name | [6-(dimethylamino)-9-[2-[2-[2-hydroxy-3-methoxy-6-(methylcarbamoyl)phenyl]-6-methoxy-3-(methylcarbamoyl)phenoxy]carbonylphenyl]xanthen-3-ylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 52938936 |
| Molecular Formula | C42H41ClN4O8 |
| Molecular Weight | 765.26 g/mol |
| Exact Mass | 764.26 |
| IUPAC Name | [6-(dimethylamino)-9-[2-[2-[2-hydroxy-3-methoxy-6-(methylcarbamoyl)phenyl]-6-methoxy-3-(methylcarbamoyl)phenoxy]carbonylphenyl]xanthen-3-ylidene]-dimethylazanium chloride |
| SMILES | CNC(=O)c1ccc(OC)c(O)c1-c1c(C(=O)NC)ccc(OC)c1OC(=O)c1ccccc1-c1c2ccc(=[N+](C)C)cc-2oc2cc(N(C)C)ccc12.[Cl-] |
| InChI | InChI=1S/C42H40N4O8.ClH/c1-43-40(48)29-17-19-31(51-7)38(47)36(29)37-30(41(49)44-2)18-20-32(52-8)39(37)54-42(50)26-12-10-9-11-25(26)35-27-15-13-23(45(3)4)21-33(27)53-34-22-24(46(5)6)14-16-28(34)35;/h9-22H,1-8H3,(H2-,43,44,47,48,49);1H |
| InChIKey | HOUXPYUNCWJMDW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|